C28H27FN6O2 — CID 71092874
[4-[[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]methyl]piperidin-1-yl]-(2-fluoro-3-pyridinyl)methanone (PubChem CID 71092874) has the molecular formula C28H27FN6O2 and a molecular weight of 498.56 g/mol. Its IUPAC name is [4-[[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]methyl]piperidin-1-yl]-(2-fluoro-3-pyridinyl)methanone.
| Compound Name | [4-[[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]methyl]piperidin-1-yl]-(2-fluoro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 71092874 |
| Molecular Formula | C28H27FN6O2 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | [4-[[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]methyl]piperidin-1-yl]-(2-fluoro-3-pyridinyl)methanone |
| SMILES | Nc1ncnc(NCC2CCN(C(=O)c3cccnc3F)CC2)c1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C28H27FN6O2/c29-25-23(7-4-14-31-25)28(36)35-15-12-19(13-16-35)17-32-27-24(26(30)33-18-34-27)20-8-10-22(11-9-20)37-21-5-2-1-3-6-21/h1-11,14,18-19H,12-13,15-17H2,(H3,30,32,33,34) |
| InChIKey | ABMILVHRERMJLR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|