C22H21N5O3 — CID 123232459
N-[2-[6-amino-5-(4-hexa-1,3,5-trien-3-yloxyphenyl)pyrimidin-4-yl]oxyethyl]-2-cyanoprop-2-enamide (PubChem CID 123232459) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[2-[6-amino-5-(4-hexa-1,3,5-trien-3-yloxyphenyl)pyrimidin-4-yl]oxyethyl]-2-cyanoprop-2-enamide.
| Compound Name | N-[2-[6-amino-5-(4-hexa-1,3,5-trien-3-yloxyphenyl)pyrimidin-4-yl]oxyethyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 123232459 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-[2-[6-amino-5-(4-hexa-1,3,5-trien-3-yloxyphenyl)pyrimidin-4-yl]oxyethyl]-2-cyanoprop-2-enamide |
| SMILES | C=CC=C(C=C)Oc1ccc(-c2c(N)ncnc2OCCNC(=O)C(=C)C#N)cc1 |
| InChI | InChI=1S/C22H21N5O3/c1-4-6-17(5-2)30-18-9-7-16(8-10-18)19-20(24)26-14-27-22(19)29-12-11-25-21(28)15(3)13-23/h4-10,14H,1-3,11-12H2,(H,25,28)(H2,24,26,27) |
| InChIKey | AHSGAZXXQOOWBE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 123.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|