C25H17FN6O3 — CID 90225963
N-[3-[6-amino-5-[6-(2-fluorophenoxy)-3-pyridinyl]pyrimidin-4-yl]oxyphenyl]-2-cyanoprop-2-enamide (PubChem CID 90225963) has the molecular formula C25H17FN6O3 and a molecular weight of 468.45 g/mol. Its IUPAC name is N-[3-[6-amino-5-[6-(2-fluorophenoxy)-3-pyridinyl]pyrimidin-4-yl]oxyphenyl]-2-cyanoprop-2-enamide.
| Compound Name | N-[3-[6-amino-5-[6-(2-fluorophenoxy)-3-pyridinyl]pyrimidin-4-yl]oxyphenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 90225963 |
| Molecular Formula | C25H17FN6O3 |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | N-[3-[6-amino-5-[6-(2-fluorophenoxy)-3-pyridinyl]pyrimidin-4-yl]oxyphenyl]-2-cyanoprop-2-enamide |
| SMILES | C=C(C#N)C(=O)Nc1cccc(Oc2ncnc(N)c2-c2ccc(Oc3ccccc3F)nc2)c1 |
| InChI | InChI=1S/C25H17FN6O3/c1-15(12-27)24(33)32-17-5-4-6-18(11-17)34-25-22(23(28)30-14-31-25)16-9-10-21(29-13-16)35-20-8-3-2-7-19(20)26/h2-11,13-14H,1H2,(H,32,33)(H2,28,30,31) |
| InChIKey | WCDPHWIFRNXVCH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|