C26H20N6O2 — CID 90226010
N-[3-[4-amino-6-(4-phenoxyanilino)pyrimidin-5-yl]phenyl]-2-cyanoprop-2-enamide (PubChem CID 90226010) has the molecular formula C26H20N6O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is N-[3-[4-amino-6-(4-phenoxyanilino)pyrimidin-5-yl]phenyl]-2-cyanoprop-2-enamide.
| Compound Name | N-[3-[4-amino-6-(4-phenoxyanilino)pyrimidin-5-yl]phenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 90226010 |
| Molecular Formula | C26H20N6O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[3-[4-amino-6-(4-phenoxyanilino)pyrimidin-5-yl]phenyl]-2-cyanoprop-2-enamide |
| SMILES | C=C(C#N)C(=O)Nc1cccc(-c2c(N)ncnc2Nc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C26H20N6O2/c1-17(15-27)26(33)32-20-7-5-6-18(14-20)23-24(28)29-16-30-25(23)31-19-10-12-22(13-11-19)34-21-8-3-2-4-9-21/h2-14,16H,1H2,(H,32,33)(H3,28,29,30,31) |
| InChIKey | VEPGNJICATZFSP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|