C25H21F3N6O2 — CID 90226009
N-[3-[[6-amino-5-[4-[3-(trifluoromethyl)phenoxy]phenyl]pyrimidin-4-yl]amino]cyclobutyl]-2-cyanoprop-2-enamide (PubChem CID 90226009) has the molecular formula C25H21F3N6O2 and a molecular weight of 494.48 g/mol. Its IUPAC name is N-[3-[[6-amino-5-[4-[3-(trifluoromethyl)phenoxy]phenyl]pyrimidin-4-yl]amino]cyclobutyl]-2-cyanoprop-2-enamide.
| Compound Name | N-[3-[[6-amino-5-[4-[3-(trifluoromethyl)phenoxy]phenyl]pyrimidin-4-yl]amino]cyclobutyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 90226009 |
| Molecular Formula | C25H21F3N6O2 |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | N-[3-[[6-amino-5-[4-[3-(trifluoromethyl)phenoxy]phenyl]pyrimidin-4-yl]amino]cyclobutyl]-2-cyanoprop-2-enamide |
| SMILES | C=C(C#N)C(=O)NC1CC(Nc2ncnc(N)c2-c2ccc(Oc3cccc(C(F)(F)F)c3)cc2)C1 |
| InChI | InChI=1S/C25H21F3N6O2/c1-14(12-29)24(35)34-18-10-17(11-18)33-23-21(22(30)31-13-32-23)15-5-7-19(8-6-15)36-20-4-2-3-16(9-20)25(26,27)28/h2-9,13,17-18H,1,10-11H2,(H,34,35)(H3,30,31,32,33) |
| InChIKey | LCEQSQIWEQTBGN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|