C25H18FN7O2 — CID 167248013
N-[4-[6-amino-5-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]pyrimidin-4-yl]phenyl]-2-cyanoprop-2-enamide (PubChem CID 167248013) has the molecular formula C25H18FN7O2 and a molecular weight of 467.46 g/mol. Its IUPAC name is N-[4-[6-amino-5-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]pyrimidin-4-yl]phenyl]-2-cyanoprop-2-enamide.
| Compound Name | N-[4-[6-amino-5-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]pyrimidin-4-yl]phenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 167248013 |
| Molecular Formula | C25H18FN7O2 |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | N-[4-[6-amino-5-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]pyrimidin-4-yl]phenyl]-2-cyanoprop-2-enamide |
| SMILES | C=C(C#N)C(=O)Nc1ccc(-c2ncnc(N)c2-c2ccc(Oc3nccc(C)n3)c(F)c2)cc1 |
| InChI | InChI=1S/C25H18FN7O2/c1-14(12-27)24(34)33-18-6-3-16(4-7-18)22-21(23(28)31-13-30-22)17-5-8-20(19(26)11-17)35-25-29-10-9-15(2)32-25/h3-11,13H,1H2,2H3,(H,33,34)(H2,28,30,31) |
| InChIKey | LGCANEGTBYUTEE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|