C28H19B5FN7O2 — CID 163377370
CID 163377370 (PubChem CID 163377370) has the molecular formula C28H19B5FN7O2 and a molecular weight of 558.57 g/mol.
| Compound Name | CID 163377370 |
|---|---|
| PubChem CID | 163377370 |
| Molecular Formula | C28H19B5FN7O2 |
| Molecular Weight | 558.57 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | — |
| SMILES | [B]C([B])=C(C(=O)Nc1ccc(-c2c(-c3ccc(Oc4nccc(C)n4)c(F)c3)c3c(N)ncnc3n2C)cc1)C([B])([B])[B] |
| InChI | InChI=1S/C28H19B5FN7O2/c1-13-9-10-36-27(39-13)43-18-8-5-15(11-17(18)34)19-20-24(35)37-12-38-25(20)41(2)22(19)14-3-6-16(7-4-14)40-26(42)21(23(29)30)28(31,32)33/h3-12H,1-2H3,(H,40,42)(H2,35,37,38) |
| InChIKey | QOQJPPOPKIREKS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|