C25H23N5O4 — CID 89266728
4-[4-[4-amino-6-[(4-prop-2-enoylmorpholin-2-yl)methoxy]pyrimidin-5-yl]phenoxy]benzonitrile (PubChem CID 89266728) has the molecular formula C25H23N5O4 and a molecular weight of 457.49 g/mol. Its IUPAC name is 4-[4-[4-amino-6-[(4-prop-2-enoylmorpholin-2-yl)methoxy]pyrimidin-5-yl]phenoxy]benzonitrile.
| Compound Name | 4-[4-[4-amino-6-[(4-prop-2-enoylmorpholin-2-yl)methoxy]pyrimidin-5-yl]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 89266728 |
| Molecular Formula | C25H23N5O4 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 4-[4-[4-amino-6-[(4-prop-2-enoylmorpholin-2-yl)methoxy]pyrimidin-5-yl]phenoxy]benzonitrile |
| SMILES | C=CC(=O)N1CCOC(COc2ncnc(N)c2-c2ccc(Oc3ccc(C#N)cc3)cc2)C1 |
| InChI | InChI=1S/C25H23N5O4/c1-2-22(31)30-11-12-32-21(14-30)15-33-25-23(24(27)28-16-29-25)18-5-9-20(10-6-18)34-19-7-3-17(13-26)4-8-19/h2-10,16,21H,1,11-12,14-15H2,(H2,27,28,29) |
| InChIKey | FHOXQIJFLYZUQL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 123.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|