C27H22N6O3 — CID 90225850
4-[4-[4-amino-6-[[2-(2-cyanoprop-2-enoyl)-2-azaspiro[3.3]heptan-6-yl]oxy]pyrimidin-5-yl]phenoxy]benzonitrile (PubChem CID 90225850) has the molecular formula C27H22N6O3 and a molecular weight of 478.51 g/mol. Its IUPAC name is 4-[4-[4-amino-6-[[2-(2-cyanoprop-2-enoyl)-2-azaspiro[3.3]heptan-6-yl]oxy]pyrimidin-5-yl]phenoxy]benzonitrile.
| Compound Name | 4-[4-[4-amino-6-[[2-(2-cyanoprop-2-enoyl)-2-azaspiro[3.3]heptan-6-yl]oxy]pyrimidin-5-yl]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 90225850 |
| Molecular Formula | C27H22N6O3 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 4-[4-[4-amino-6-[[2-(2-cyanoprop-2-enoyl)-2-azaspiro[3.3]heptan-6-yl]oxy]pyrimidin-5-yl]phenoxy]benzonitrile |
| SMILES | C=C(C#N)C(=O)N1CC2(CC(Oc3ncnc(N)c3-c3ccc(Oc4ccc(C#N)cc4)cc3)C2)C1 |
| InChI | InChI=1S/C27H22N6O3/c1-17(12-28)26(34)33-14-27(15-33)10-22(11-27)36-25-23(24(30)31-16-32-25)19-4-8-21(9-5-19)35-20-6-2-18(13-29)3-7-20/h2-9,16,22H,1,10-11,14-15H2,(H2,30,31,32) |
| InChIKey | IOVRMUULBXWEOR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|