C28H28N6O2 — CID 90225976
2-[8-[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]-2,8-diazaspiro[4.5]decane-2-carbonyl]prop-2-enenitrile (PubChem CID 90225976) has the molecular formula C28H28N6O2 and a molecular weight of 480.57 g/mol. Its IUPAC name is 2-[8-[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]-2,8-diazaspiro[4.5]decane-2-carbonyl]prop-2-enenitrile.
| Compound Name | 2-[8-[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]-2,8-diazaspiro[4.5]decane-2-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 90225976 |
| Molecular Formula | C28H28N6O2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 2-[8-[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]-2,8-diazaspiro[4.5]decane-2-carbonyl]prop-2-enenitrile |
| SMILES | C=C(C#N)C(=O)N1CCC2(CCN(c3ncnc(N)c3-c3ccc(Oc4ccccc4)cc3)CC2)C1 |
| InChI | InChI=1S/C28H28N6O2/c1-20(17-29)27(35)34-16-13-28(18-34)11-14-33(15-12-28)26-24(25(30)31-19-32-26)21-7-9-23(10-8-21)36-22-5-3-2-4-6-22/h2-10,19H,1,11-16,18H2,(H2,30,31,32) |
| InChIKey | VFSJMDODBSGNJN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|