C17H21ClN2O4 — CID 172889633
N-[2-(4-chlorophenoxy)ethyl]-2-[(2R)-4-prop-2-enoylmorpholin-2-yl]acetamide (PubChem CID 172889633) has the molecular formula C17H21ClN2O4 and a molecular weight of 352.82 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-2-[(2R)-4-prop-2-enoylmorpholin-2-yl]acetamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-2-[(2R)-4-prop-2-enoylmorpholin-2-yl]acetamide |
|---|---|
| PubChem CID | 172889633 |
| Molecular Formula | C17H21ClN2O4 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-2-[(2R)-4-prop-2-enoylmorpholin-2-yl]acetamide |
| SMILES | C=CC(=O)N1CCO[C@H](CC(=O)NCCOc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H21ClN2O4/c1-2-17(22)20-8-10-24-15(12-20)11-16(21)19-7-9-23-14-5-3-13(18)4-6-14/h2-6,15H,1,7-12H2,(H,19,21)/t15-/m1/s1 |
| InChIKey | SKNVYMOKTVXUOY-OAHLLOKOSA-N |
| XLogP | 1.64 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|