C17H22N2O3 — CID 172889629
N-(4-ethylphenyl)-2-[(2R)-4-prop-2-enoylmorpholin-2-yl]acetamide (PubChem CID 172889629) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[(2R)-4-prop-2-enoylmorpholin-2-yl]acetamide.
| Compound Name | N-(4-ethylphenyl)-2-[(2R)-4-prop-2-enoylmorpholin-2-yl]acetamide |
|---|---|
| PubChem CID | 172889629 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-(4-ethylphenyl)-2-[(2R)-4-prop-2-enoylmorpholin-2-yl]acetamide |
| SMILES | C=CC(=O)N1CCO[C@H](CC(=O)Nc2ccc(CC)cc2)C1 |
| InChI | InChI=1S/C17H22N2O3/c1-3-13-5-7-14(8-6-13)18-16(20)11-15-12-19(9-10-22-15)17(21)4-2/h4-8,15H,2-3,9-12H2,1H3,(H,18,20)/t15-/m1/s1 |
| InChIKey | GPHSAYMGLRYAJO-OAHLLOKOSA-N |
| XLogP | 1.99 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|