C17H20ClFN2O3 — CID 172888379
N-[2-(2-chloro-6-fluorophenyl)ethyl]-2-[(2S)-4-prop-2-enoylmorpholin-2-yl]acetamide (PubChem CID 172888379) has the molecular formula C17H20ClFN2O3 and a molecular weight of 354.81 g/mol. Its IUPAC name is N-[2-(2-chloro-6-fluorophenyl)ethyl]-2-[(2S)-4-prop-2-enoylmorpholin-2-yl]acetamide.
| Compound Name | N-[2-(2-chloro-6-fluorophenyl)ethyl]-2-[(2S)-4-prop-2-enoylmorpholin-2-yl]acetamide |
|---|---|
| PubChem CID | 172888379 |
| Molecular Formula | C17H20ClFN2O3 |
| Molecular Weight | 354.81 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-[2-(2-chloro-6-fluorophenyl)ethyl]-2-[(2S)-4-prop-2-enoylmorpholin-2-yl]acetamide |
| SMILES | C=CC(=O)N1CCO[C@@H](CC(=O)NCCc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C17H20ClFN2O3/c1-2-17(23)21-8-9-24-12(11-21)10-16(22)20-7-6-13-14(18)4-3-5-15(13)19/h2-5,12H,1,6-11H2,(H,20,22)/t12-/m0/s1 |
| InChIKey | PRWKOHJNWZXRLX-LBPRGKRZSA-N |
| XLogP | 1.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.81 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|