C17H18ClFN2O — CID 71851042
N-[2-(2-chloro-6-fluorophenyl)ethyl]-4-pyridin-2-ylbutanamide (PubChem CID 71851042) has the molecular formula C17H18ClFN2O and a molecular weight of 320.79 g/mol. Its IUPAC name is N-[2-(2-chloro-6-fluorophenyl)ethyl]-4-pyridin-2-ylbutanamide.
| Compound Name | N-[2-(2-chloro-6-fluorophenyl)ethyl]-4-pyridin-2-ylbutanamide |
|---|---|
| PubChem CID | 71851042 |
| Molecular Formula | C17H18ClFN2O |
| Molecular Weight | 320.79 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | N-[2-(2-chloro-6-fluorophenyl)ethyl]-4-pyridin-2-ylbutanamide |
| SMILES | O=C(CCCc1ccccn1)NCCc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H18ClFN2O/c18-15-7-4-8-16(19)14(15)10-12-21-17(22)9-3-6-13-5-1-2-11-20-13/h1-2,4-5,7-8,11H,3,6,9-10,12H2,(H,21,22) |
| InChIKey | AJLSARVMQUSIOK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.79 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |