C11H13ClFNO2 — CID 94688694
N-[(2-chloro-6-fluorophenyl)methyl]-4-hydroxybutanamide (PubChem CID 94688694) has the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-4-hydroxybutanamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-4-hydroxybutanamide |
|---|---|
| PubChem CID | 94688694 |
| Molecular Formula | C11H13ClFNO2 |
| Molecular Weight | 245.68 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-4-hydroxybutanamide |
| SMILES | O=C(CCCO)NCc1c(F)cccc1Cl |
| InChI | InChI=1S/C11H13ClFNO2/c12-9-3-1-4-10(13)8(9)7-14-11(16)5-2-6-15/h1,3-4,15H,2,5-7H2,(H,14,16) |
| InChIKey | IVZOCZFTIAKCNR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.68 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |