C16H21ClN2O4 — CID 122120902
(3S,4S)-1-[2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl]-4-methylpyrrolidine-3-carboxylic acid (PubChem CID 122120902) has the molecular formula C16H21ClN2O4 and a molecular weight of 340.81 g/mol. Its IUPAC name is (3S,4S)-1-[2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl]-4-methylpyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-[2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl]-4-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122120902 |
| Molecular Formula | C16H21ClN2O4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (3S,4S)-1-[2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl]-4-methylpyrrolidine-3-carboxylic acid |
| SMILES | C[C@@H]1CN(CC(=O)NCCOc2ccc(Cl)cc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C16H21ClN2O4/c1-11-8-19(9-14(11)16(21)22)10-15(20)18-6-7-23-13-4-2-12(17)3-5-13/h2-5,11,14H,6-10H2,1H3,(H,18,20)(H,21,22)/t11-,14-/m1/s1 |
| InChIKey | FPVRYXRTXAVNAU-BXUZGUMPSA-N |
| XLogP | 1.49 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|