C23H30ClN3O4 — CID 35885849
N-[2-(4-chlorophenoxy)ethyl]-2-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 35885849) has the molecular formula C23H30ClN3O4 and a molecular weight of 447.96 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-2-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-2-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 35885849 |
| Molecular Formula | C23H30ClN3O4 |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-2-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | COc1ccc(CN2CCN(CC(=O)NCCOc3ccc(Cl)cc3)CC2)cc1OC |
| InChI | InChI=1S/C23H30ClN3O4/c1-29-21-8-3-18(15-22(21)30-2)16-26-10-12-27(13-11-26)17-23(28)25-9-14-31-20-6-4-19(24)5-7-20/h3-8,15H,9-14,16-17H2,1-2H3,(H,25,28) |
| InChIKey | LJKJDTIVFATXTH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|