C17H26ClN3O3 — CID 31001529
2-[4-[(5-chloro-2-methoxyphenyl)methyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 31001529) has the molecular formula C17H26ClN3O3 and a molecular weight of 355.87 g/mol. Its IUPAC name is 2-[4-[(5-chloro-2-methoxyphenyl)methyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-[(5-chloro-2-methoxyphenyl)methyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 31001529 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 2-[4-[(5-chloro-2-methoxyphenyl)methyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN1CCN(Cc2cc(Cl)ccc2OC)CC1 |
| InChI | InChI=1S/C17H26ClN3O3/c1-23-10-5-19-17(22)13-21-8-6-20(7-9-21)12-14-11-15(18)3-4-16(14)24-2/h3-4,11H,5-10,12-13H2,1-2H3,(H,19,22) |
| InChIKey | PUJFALQGKLYQOS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|