C20H24ClN3O5 — CID 11929755
N-[2-(4-chlorophenoxy)ethyl]-2-[3-[(1S,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 11929755) has the molecular formula C20H24ClN3O5 and a molecular weight of 421.88 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-2-[3-[(1S,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-2-[3-[(1S,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 11929755 |
| Molecular Formula | C20H24ClN3O5 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-2-[3-[(1S,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@H]1CCCC[C@@H]1N1C(=O)C(=O)N(CC(=O)NCCOc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C20H24ClN3O5/c1-13-4-2-3-5-16(13)24-19(27)18(26)23(20(24)28)12-17(25)22-10-11-29-15-8-6-14(21)7-9-15/h6-9,13,16H,2-5,10-12H2,1H3,(H,22,25)/t13-,16-/m0/s1 |
| InChIKey | DNMXXLBMDZVZDL-BBRMVZONSA-N |
| XLogP | 2.20 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|