C18H19ClFN3O4 — CID 7799669
N-(5-chloro-2-fluorophenyl)-2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 7799669) has the molecular formula C18H19ClFN3O4 and a molecular weight of 395.82 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 7799669 |
| Molecular Formula | C18H19ClFN3O4 |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@H]1CCCC[C@H]1N1C(=O)C(=O)N(CC(=O)Nc2cc(Cl)ccc2F)C1=O |
| InChI | InChI=1S/C18H19ClFN3O4/c1-10-4-2-3-5-14(10)23-17(26)16(25)22(18(23)27)9-15(24)21-13-8-11(19)6-7-12(13)20/h6-8,10,14H,2-5,9H2,1H3,(H,21,24)/t10-,14+/m0/s1 |
| InChIKey | NJKMSNXAZKZXFX-IINYFYTJSA-N |
| XLogP | 2.79 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|