C18H27N3O3 — CID 128987186
(3S,4S)-1-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]-4-methylpyrrolidine-3-carboxamide (PubChem CID 128987186) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is (3S,4S)-1-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]-4-methylpyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-1-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]-4-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 128987186 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (3S,4S)-1-[2-[2-(2,6-dimethylphenoxy)ethylamino]-2-oxoethyl]-4-methylpyrrolidine-3-carboxamide |
| SMILES | Cc1cccc(C)c1OCCNC(=O)CN1C[C@@H](C)[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C18H27N3O3/c1-12-5-4-6-13(2)17(12)24-8-7-20-16(22)11-21-9-14(3)15(10-21)18(19)23/h4-6,14-15H,7-11H2,1-3H3,(H2,19,23)(H,20,22)/t14-,15-/m1/s1 |
| InChIKey | QWCBHUMSPDLDQU-HUUCEWRRSA-N |
| XLogP | 0.85 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|