C26H23N3O3 — CID 123813703
N-[3-[2-amino-4-(4-phenoxycyclohexa-1,5-dien-1-yl)oxy-3-pyridinyl]phenyl]prop-2-enamide (PubChem CID 123813703) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[3-[2-amino-4-(4-phenoxycyclohexa-1,5-dien-1-yl)oxy-3-pyridinyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-amino-4-(4-phenoxycyclohexa-1,5-dien-1-yl)oxy-3-pyridinyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 123813703 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-[3-[2-amino-4-(4-phenoxycyclohexa-1,5-dien-1-yl)oxy-3-pyridinyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2c(OC3=CCC(Oc4ccccc4)C=C3)ccnc2N)c1 |
| InChI | InChI=1S/C26H23N3O3/c1-2-24(30)29-19-8-6-7-18(17-19)25-23(15-16-28-26(25)27)32-22-13-11-21(12-14-22)31-20-9-4-3-5-10-20/h2-11,13-17,21H,1,12H2,(H2,27,28)(H,29,30) |
| InChIKey | WUKVUPSLTFCYSN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|