C22H22N4O — CID 90209235
N-[3-[2-amino-4-[[(1R)-1-phenylethyl]amino]-3-pyridinyl]phenyl]prop-2-enamide (PubChem CID 90209235) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is N-[3-[2-amino-4-[[(1R)-1-phenylethyl]amino]-3-pyridinyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-amino-4-[[(1R)-1-phenylethyl]amino]-3-pyridinyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90209235 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-[3-[2-amino-4-[[(1R)-1-phenylethyl]amino]-3-pyridinyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2c(N[C@H](C)c3ccccc3)ccnc2N)c1 |
| InChI | InChI=1S/C22H22N4O/c1-3-20(27)26-18-11-7-10-17(14-18)21-19(12-13-24-22(21)23)25-15(2)16-8-5-4-6-9-16/h3-15H,1H2,2H3,(H,26,27)(H3,23,24,25)/t15-/m1/s1 |
| InChIKey | CDQBZIIGIMNBHD-OAHLLOKOSA-N |
| XLogP | 4.63 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|