C32H26N4O4 — CID 59322656
[(2S)-2-phenyl-2-[[6-phenyl-5-[3-(prop-2-enoylamino)phenyl]furo[2,3-d]pyrimidin-4-yl]amino]ethyl] prop-2-enoate (PubChem CID 59322656) has the molecular formula C32H26N4O4 and a molecular weight of 530.58 g/mol. Its IUPAC name is [(2S)-2-phenyl-2-[[6-phenyl-5-[3-(prop-2-enoylamino)phenyl]furo[2,3-d]pyrimidin-4-yl]amino]ethyl] prop-2-enoate.
| Compound Name | [(2S)-2-phenyl-2-[[6-phenyl-5-[3-(prop-2-enoylamino)phenyl]furo[2,3-d]pyrimidin-4-yl]amino]ethyl] prop-2-enoate |
|---|---|
| PubChem CID | 59322656 |
| Molecular Formula | C32H26N4O4 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | [(2S)-2-phenyl-2-[[6-phenyl-5-[3-(prop-2-enoylamino)phenyl]furo[2,3-d]pyrimidin-4-yl]amino]ethyl] prop-2-enoate |
| SMILES | C=CC(=O)Nc1cccc(-c2c(-c3ccccc3)oc3ncnc(N[C@H](COC(=O)C=C)c4ccccc4)c23)c1 |
| InChI | InChI=1S/C32H26N4O4/c1-3-26(37)35-24-17-11-16-23(18-24)28-29-31(33-20-34-32(29)40-30(28)22-14-9-6-10-15-22)36-25(19-39-27(38)4-2)21-12-7-5-8-13-21/h3-18,20,25H,1-2,19H2,(H,35,37)(H,33,34,36)/t25-/m1/s1 |
| InChIKey | IGTPLFLITLONHT-RUZDIDTESA-N |
| XLogP | 6.56 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|