C32H31N5O3 — CID 68593347
(E)-4-(dimethylamino)-N-[3-[4-[(2-hydroxy-1-phenylethyl)amino]-6-phenylfuro[2,3-d]pyrimidin-5-yl]phenyl]but-2-enamide (PubChem CID 68593347) has the molecular formula C32H31N5O3 and a molecular weight of 533.63 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-[3-[4-[(2-hydroxy-1-phenylethyl)amino]-6-phenylfuro[2,3-d]pyrimidin-5-yl]phenyl]but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-[3-[4-[(2-hydroxy-1-phenylethyl)amino]-6-phenylfuro[2,3-d]pyrimidin-5-yl]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 68593347 |
| Molecular Formula | C32H31N5O3 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | (E)-4-(dimethylamino)-N-[3-[4-[(2-hydroxy-1-phenylethyl)amino]-6-phenylfuro[2,3-d]pyrimidin-5-yl]phenyl]but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cccc(-c2c(-c3ccccc3)oc3ncnc(NC(CO)c4ccccc4)c23)c1 |
| InChI | InChI=1S/C32H31N5O3/c1-37(2)18-10-17-27(39)35-25-16-9-15-24(19-25)28-29-31(36-26(20-38)22-11-5-3-6-12-22)33-21-34-32(29)40-30(28)23-13-7-4-8-14-23/h3-17,19,21,26,38H,18,20H2,1-2H3,(H,35,39)(H,33,34,36)/b17-10+ |
| InChIKey | NQAMTZUVRFRJCZ-LICLKQGHSA-N |
| XLogP | 5.76 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|