C25H26FN3O4 — CID 139271244
tert-butyl N-[2-[2-fluoro-4-(5-nitro-3-phenyl-2-pyridinyl)phenyl]propan-2-yl]carbamate (PubChem CID 139271244) has the molecular formula C25H26FN3O4 and a molecular weight of 451.50 g/mol. Its IUPAC name is tert-butyl N-[2-[2-fluoro-4-(5-nitro-3-phenyl-2-pyridinyl)phenyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-[2-fluoro-4-(5-nitro-3-phenyl-2-pyridinyl)phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 139271244 |
| Molecular Formula | C25H26FN3O4 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | tert-butyl N-[2-[2-fluoro-4-(5-nitro-3-phenyl-2-pyridinyl)phenyl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)c1ccc(-c2ncc([N+](=O)[O-])cc2-c2ccccc2)cc1F |
| InChI | InChI=1S/C25H26FN3O4/c1-24(2,3)33-23(30)28-25(4,5)20-12-11-17(13-21(20)26)22-19(16-9-7-6-8-10-16)14-18(15-27-22)29(31)32/h6-15H,1-5H3,(H,28,30) |
| InChIKey | XFUBVLRWTXFGNZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|