C19H20ClN3O4 — CID 140840550
tert-butyl N-[1-[4-(3-chloro-5-nitro-2-pyridinyl)phenyl]cyclopropyl]carbamate (PubChem CID 140840550) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(3-chloro-5-nitro-2-pyridinyl)phenyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(3-chloro-5-nitro-2-pyridinyl)phenyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 140840550 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | tert-butyl N-[1-[4-(3-chloro-5-nitro-2-pyridinyl)phenyl]cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(-c3ncc([N+](=O)[O-])cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C19H20ClN3O4/c1-18(2,3)27-17(24)22-19(8-9-19)13-6-4-12(5-7-13)16-15(20)10-14(11-21-16)23(25)26/h4-7,10-11H,8-9H2,1-3H3,(H,22,24) |
| InChIKey | LGNWOVFFFSWONT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|