C19H23ClN4O2 — CID 56954771
tert-butyl N-[1-[4-(5-amino-3-chloropyrazin-2-yl)phenyl]cyclobutyl]carbamate (PubChem CID 56954771) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(5-amino-3-chloropyrazin-2-yl)phenyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(5-amino-3-chloropyrazin-2-yl)phenyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 56954771 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | tert-butyl N-[1-[4-(5-amino-3-chloropyrazin-2-yl)phenyl]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(-c3ncc(N)nc3Cl)cc2)CCC1 |
| InChI | InChI=1S/C19H23ClN4O2/c1-18(2,3)26-17(25)24-19(9-4-10-19)13-7-5-12(6-8-13)15-16(20)23-14(21)11-22-15/h5-8,11H,4,9-10H2,1-3H3,(H2,21,23)(H,24,25) |
| InChIKey | NRXDXZMQLFBWRK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |