About tert-butyl N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclobutyl]carbamate
tert-butyl N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclobutyl]carbamate (PubChem CID 175356304) has the molecular formula C19H24N2O2S
and a molecular weight of 344.48 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclobutyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclobutyl]carbamate |
| PubChem CID | 175356304 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | tert-butyl N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclobutyl]carbamate |
| SMILES | Cc1ncsc1-c1ccc(C2(NC(=O)OC(C)(C)C)CCC2)cc1 |
| InChI | InChI=1S/C19H24N2O2S/c1-13-16(24-12-20-13)14-6-8-15(9-7-14)19(10-5-11-19)21-17(22)23-18(2,3)4/h6-9,12H,5,10-11H2,1-4H3,(H,21,22) |
| InChIKey | ZRZZVWAULTUDQK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclobutyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclobutyl]carbamate?
The IUPAC name of tert-butyl N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclobutyl]carbamate (CID 175356304) is tert-butyl N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclobutyl]carbamate.
What is the SMILES notation for tert-butyl N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclobutyl]carbamate?
The canonical SMILES for tert-butyl N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclobutyl]carbamate is Cc1ncsc1-c1ccc(C2(NC(=O)OC(C)(C)C)CCC2)cc1.
What is the InChIKey of tert-butyl N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclobutyl]carbamate?
The InChIKey is ZRZZVWAULTUDQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O2S/c1-13-16(24-12-20-13)14-6-8-15(9-7-14)19(10-5-11-19)21-17(22)23-18(2,3)4/h6-9,12H,5,10-11H2,1-4H3,(H,21,22).
What are the key properties of tert-butyl N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclobutyl]carbamate?
tert-butyl N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclobutyl]carbamate has a molecular weight of 344.48 g/mol, XLogP of 5.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclobutyl]carbamate is sourced from PubChem (CID 175356304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).