C21H28N2O3S — CID 171104855
tert-butyl N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]-6-oxohexyl]carbamate (PubChem CID 171104855) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 171104855 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | tert-butyl N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]-6-oxohexyl]carbamate |
| SMILES | Cc1ncsc1-c1ccc([C@H](CCCCC=O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H28N2O3S/c1-15-19(27-14-22-15)17-11-9-16(10-12-17)18(8-6-5-7-13-24)23-20(25)26-21(2,3)4/h9-14,18H,5-8H2,1-4H3,(H,23,25)/t18-/m0/s1 |
| InChIKey | WJPSPQPMGXWJMI-SFHVURJKSA-N |
| XLogP | 5.44 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|