C23H34N2O3S — CID 176629165
tert-butyl N-[(1R)-2-(3,3-dimethylbutoxy)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamate (PubChem CID 176629165) has the molecular formula C23H34N2O3S and a molecular weight of 418.60 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-(3,3-dimethylbutoxy)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-(3,3-dimethylbutoxy)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 176629165 |
| Molecular Formula | C23H34N2O3S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | tert-butyl N-[(1R)-2-(3,3-dimethylbutoxy)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamate |
| SMILES | Cc1ncsc1-c1ccc([C@H](COCCC(C)(C)C)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H34N2O3S/c1-16-20(29-15-24-16)18-10-8-17(9-11-18)19(14-27-13-12-22(2,3)4)25-21(26)28-23(5,6)7/h8-11,15,19H,12-14H2,1-7H3,(H,25,26)/t19-/m0/s1 |
| InChIKey | QLUUEPWYNKTGRY-IBGZPJMESA-N |
| XLogP | 6.14 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|