C19H29N3O3S — CID 146179187
(1R)-2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine (PubChem CID 146179187) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is (1R)-2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine.
| Compound Name | (1R)-2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 146179187 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (1R)-2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine |
| SMILES | CNCCOCCOCCOC[C@H](N)c1ccc(-c2scnc2C)cc1 |
| InChI | InChI=1S/C19H29N3O3S/c1-15-19(26-14-22-15)17-5-3-16(4-6-17)18(20)13-25-12-11-24-10-9-23-8-7-21-2/h3-6,14,18,21H,7-13,20H2,1-2H3/t18-/m0/s1 |
| InChIKey | GKRLLKMKGMSKQP-SFHVURJKSA-N |
| XLogP | 2.39 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|