C11H12N2OS — CID 142573108
N-[4-(4-methyl-1,3-thiazol-5-yl)phenoxy]methanamine (PubChem CID 142573108) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is N-[4-(4-methyl-1,3-thiazol-5-yl)phenoxy]methanamine.
| Compound Name | N-[4-(4-methyl-1,3-thiazol-5-yl)phenoxy]methanamine |
|---|---|
| PubChem CID | 142573108 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | N-[4-(4-methyl-1,3-thiazol-5-yl)phenoxy]methanamine |
| SMILES | CNOc1ccc(-c2scnc2C)cc1 |
| InChI | InChI=1S/C11H12N2OS/c1-8-11(15-7-13-8)9-3-5-10(6-4-9)14-12-2/h3-7,12H,1-2H3 |
| InChIKey | PTIYYMNGVSZUCI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|