C13H16ClN3S — CID 175127479
1-cyclopropyl-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]hydrazine;hydrochloride (PubChem CID 175127479) has the molecular formula C13H16ClN3S and a molecular weight of 281.81 g/mol. Its IUPAC name is 1-cyclopropyl-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]hydrazine;hydrochloride.
| Compound Name | 1-cyclopropyl-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]hydrazine;hydrochloride |
|---|---|
| PubChem CID | 175127479 |
| Molecular Formula | C13H16ClN3S |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 1-cyclopropyl-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]hydrazine;hydrochloride |
| SMILES | Cc1ncsc1-c1ccc(N(N)C2CC2)cc1.Cl |
| InChI | InChI=1S/C13H15N3S.ClH/c1-9-13(17-8-15-9)10-2-4-11(5-3-10)16(14)12-6-7-12;/h2-5,8,12H,6-7,14H2,1H3;1H |
| InChIKey | FNJYGLHAXAXASR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|