C12H14N2O2S — CID 178069167
(2R)-2-amino-2-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethane-1,1-diol (PubChem CID 178069167) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is (2R)-2-amino-2-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethane-1,1-diol.
| Compound Name | (2R)-2-amino-2-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethane-1,1-diol |
|---|---|
| PubChem CID | 178069167 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (2R)-2-amino-2-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethane-1,1-diol |
| SMILES | Cc1ncsc1-c1ccc([C@@H](N)C(O)O)cc1 |
| InChI | InChI=1S/C12H14N2O2S/c1-7-11(17-6-14-7)9-4-2-8(3-5-9)10(13)12(15)16/h2-6,10,12,15-16H,13H2,1H3/t10-/m1/s1 |
| InChIKey | ZMBUWEKTOWTWRF-SNVBAGLBSA-N |
| XLogP | 1.43 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|