C14H15NS — CID 156886524
5-[4-[(2S)-but-3-en-2-yl]phenyl]-4-methyl-1,3-thiazole (PubChem CID 156886524) has the molecular formula C14H15NS and a molecular weight of 229.35 g/mol. Its IUPAC name is 5-[4-[(2S)-but-3-en-2-yl]phenyl]-4-methyl-1,3-thiazole.
| Compound Name | 5-[4-[(2S)-but-3-en-2-yl]phenyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 156886524 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 5-[4-[(2S)-but-3-en-2-yl]phenyl]-4-methyl-1,3-thiazole |
| SMILES | C=C[C@H](C)c1ccc(-c2scnc2C)cc1 |
| InChI | InChI=1S/C14H15NS/c1-4-10(2)12-5-7-13(8-6-12)14-11(3)15-9-16-14/h4-10H,1H2,2-3H3/t10-/m0/s1 |
| InChIKey | HCDOJLXMWVIXLI-JTQLQIEISA-N |
| XLogP | 4.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|