C19H28N4OS — CID 167039816
(3S)-3-amino-N-(6-aminohexyl)-3-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]propanamide (PubChem CID 167039816) has the molecular formula C19H28N4OS and a molecular weight of 360.53 g/mol. Its IUPAC name is (3S)-3-amino-N-(6-aminohexyl)-3-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]propanamide.
| Compound Name | (3S)-3-amino-N-(6-aminohexyl)-3-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 167039816 |
| Molecular Formula | C19H28N4OS |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (3S)-3-amino-N-(6-aminohexyl)-3-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]propanamide |
| SMILES | Cc1ncsc1-c1ccc([C@@H](N)CC(=O)NCCCCCCN)cc1 |
| InChI | InChI=1S/C19H28N4OS/c1-14-19(25-13-23-14)16-8-6-15(7-9-16)17(21)12-18(24)22-11-5-3-2-4-10-20/h6-9,13,17H,2-5,10-12,20-21H2,1H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | BJXDGRPFKSKBCQ-KRWDZBQOSA-N |
| XLogP | 3.14 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|