C16H21N3O8 — CID 6420689
ditert-butyl 2-(3,5-dinitro-2-pyridinyl)propanedioate (PubChem CID 6420689) has the molecular formula C16H21N3O8 and a molecular weight of 383.36 g/mol. Its IUPAC name is ditert-butyl 2-(3,5-dinitro-2-pyridinyl)propanedioate.
| Compound Name | ditert-butyl 2-(3,5-dinitro-2-pyridinyl)propanedioate |
|---|---|
| PubChem CID | 6420689 |
| Molecular Formula | C16H21N3O8 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | ditert-butyl 2-(3,5-dinitro-2-pyridinyl)propanedioate |
| SMILES | CC(C)(C)OC(=O)C(C(=O)OC(C)(C)C)c1ncc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21N3O8/c1-15(2,3)26-13(20)11(14(21)27-16(4,5)6)12-10(19(24)25)7-9(8-17-12)18(22)23/h7-8,11H,1-6H3 |
| InChIKey | ZTNGTBDPAZPJRX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 151.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|