C15H15F3N2O8 — CID 176883954
2-[6-methoxycarbonyl-5-nitro-3-(trifluoromethyl)-2-pyridinyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid (PubChem CID 176883954) has the molecular formula C15H15F3N2O8 and a molecular weight of 408.29 g/mol. Its IUPAC name is 2-[6-methoxycarbonyl-5-nitro-3-(trifluoromethyl)-2-pyridinyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid.
| Compound Name | 2-[6-methoxycarbonyl-5-nitro-3-(trifluoromethyl)-2-pyridinyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 176883954 |
| Molecular Formula | C15H15F3N2O8 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 2-[6-methoxycarbonyl-5-nitro-3-(trifluoromethyl)-2-pyridinyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
| SMILES | COC(=O)c1nc(C(C(=O)O)C(=O)OC(C)(C)C)c(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15F3N2O8/c1-14(2,3)28-12(23)8(11(21)22)9-6(15(16,17)18)5-7(20(25)26)10(19-9)13(24)27-4/h5,8H,1-4H3,(H,21,22) |
| InChIKey | PBQIZCXDBNUMAJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 145.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|