C19H22F3NO6 — CID 54063808
tert-butyl 4,4-dimethyl-2-[2-nitro-4-(trifluoromethyl)benzoyl]-3-oxopentanoate (PubChem CID 54063808) has the molecular formula C19H22F3NO6 and a molecular weight of 417.38 g/mol. Its IUPAC name is tert-butyl 4,4-dimethyl-2-[2-nitro-4-(trifluoromethyl)benzoyl]-3-oxopentanoate.
| Compound Name | tert-butyl 4,4-dimethyl-2-[2-nitro-4-(trifluoromethyl)benzoyl]-3-oxopentanoate |
|---|---|
| PubChem CID | 54063808 |
| Molecular Formula | C19H22F3NO6 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | tert-butyl 4,4-dimethyl-2-[2-nitro-4-(trifluoromethyl)benzoyl]-3-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)C(C(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(=O)C(C)(C)C |
| InChI | InChI=1S/C19H22F3NO6/c1-17(2,3)15(25)13(16(26)29-18(4,5)6)14(24)11-8-7-10(19(20,21)22)9-12(11)23(27)28/h7-9,13H,1-6H3 |
| InChIKey | MBOJKHRJJWTMOB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|