C16H13F3NO6- — CID 67600922
2-(cyclopentanecarbonyl)-3-[2-nitro-4-(trifluoromethyl)phenyl]-3-oxopropanoate (PubChem CID 67600922) has the molecular formula C16H13F3NO6- and a molecular weight of 372.28 g/mol. Its IUPAC name is 2-(cyclopentanecarbonyl)-3-[2-nitro-4-(trifluoromethyl)phenyl]-3-oxopropanoate.
| Compound Name | 2-(cyclopentanecarbonyl)-3-[2-nitro-4-(trifluoromethyl)phenyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 67600922 |
| Molecular Formula | C16H13F3NO6- |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-(cyclopentanecarbonyl)-3-[2-nitro-4-(trifluoromethyl)phenyl]-3-oxopropanoate |
| SMILES | O=C([O-])C(C(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(=O)C1CCCC1 |
| InChI | InChI=1S/C16H14F3NO6/c17-16(18,19)9-5-6-10(11(7-9)20(25)26)14(22)12(15(23)24)13(21)8-3-1-2-4-8/h5-8,12H,1-4H2,(H,23,24)/p-1 |
| InChIKey | OMJVATYVVDDGJW-UHFFFAOYSA-M |
| XLogP | 1.92 |
| TPSA | 117.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|