C15H14F3NO4 — CID 54035574
1-cyclopentyl-3-[2-nitro-4-(trifluoromethyl)phenyl]propane-1,3-dione (PubChem CID 54035574) has the molecular formula C15H14F3NO4 and a molecular weight of 329.27 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-nitro-4-(trifluoromethyl)phenyl]propane-1,3-dione.
| Compound Name | 1-cyclopentyl-3-[2-nitro-4-(trifluoromethyl)phenyl]propane-1,3-dione |
|---|---|
| PubChem CID | 54035574 |
| Molecular Formula | C15H14F3NO4 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 1-cyclopentyl-3-[2-nitro-4-(trifluoromethyl)phenyl]propane-1,3-dione |
| SMILES | O=C(CC(=O)C1CCCC1)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14F3NO4/c16-15(17,18)10-5-6-11(12(7-10)19(22)23)14(21)8-13(20)9-3-1-2-4-9/h5-7,9H,1-4,8H2 |
| InChIKey | LIRZFSJRWQIUEZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|