C12H10F5NO4S — CID 23283977
1-cyclopropyl-3-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]propane-1,3-dione (PubChem CID 23283977) has the molecular formula C12H10F5NO4S and a molecular weight of 359.27 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]propane-1,3-dione.
| Compound Name | 1-cyclopropyl-3-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]propane-1,3-dione |
|---|---|
| PubChem CID | 23283977 |
| Molecular Formula | C12H10F5NO4S |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 1-cyclopropyl-3-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]propane-1,3-dione |
| SMILES | O=C(CC(=O)C1CC1)c1ccc(S(F)(F)(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10F5NO4S/c13-23(14,15,16,17)8-3-4-9(10(5-8)18(21)22)12(20)6-11(19)7-1-2-7/h3-5,7H,1-2,6H2 |
| InChIKey | BVDNBJIFRVEIJJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|