C15H18F3N3O3 — CID 29409246
3-cyclopentyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]propanehydrazide (PubChem CID 29409246) has the molecular formula C15H18F3N3O3 and a molecular weight of 345.32 g/mol. Its IUPAC name is 3-cyclopentyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]propanehydrazide.
| Compound Name | 3-cyclopentyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]propanehydrazide |
|---|---|
| PubChem CID | 29409246 |
| Molecular Formula | C15H18F3N3O3 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 3-cyclopentyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]propanehydrazide |
| SMILES | O=C(CCC1CCCC1)NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18F3N3O3/c16-15(17,18)11-6-7-12(13(9-11)21(23)24)19-20-14(22)8-5-10-3-1-2-4-10/h6-7,9-10,19H,1-5,8H2,(H,20,22) |
| InChIKey | SADFVXIXDBWQKW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|