C15H10ClF4N3O3 — CID 29409225
2-(2-chloro-6-fluorophenyl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]acetohydrazide (PubChem CID 29409225) has the molecular formula C15H10ClF4N3O3 and a molecular weight of 391.71 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]acetohydrazide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]acetohydrazide |
|---|---|
| PubChem CID | 29409225 |
| Molecular Formula | C15H10ClF4N3O3 |
| Molecular Weight | 391.71 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]acetohydrazide |
| SMILES | O=C(Cc1c(F)cccc1Cl)NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10ClF4N3O3/c16-10-2-1-3-11(17)9(10)7-14(24)22-21-12-5-4-8(15(18,19)20)6-13(12)23(25)26/h1-6,21H,7H2,(H,22,24) |
| InChIKey | IOBJRYSIPGMVMZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.71 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|