C20H17F4N5O3 — CID 55794181
2-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-N'-[2-nitro-4-(trifluoromethyl)phenyl]acetohydrazide (PubChem CID 55794181) has the molecular formula C20H17F4N5O3 and a molecular weight of 451.38 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-N'-[2-nitro-4-(trifluoromethyl)phenyl]acetohydrazide.
| Compound Name | 2-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-N'-[2-nitro-4-(trifluoromethyl)phenyl]acetohydrazide |
|---|---|
| PubChem CID | 55794181 |
| Molecular Formula | C20H17F4N5O3 |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 2-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-N'-[2-nitro-4-(trifluoromethyl)phenyl]acetohydrazide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1CC(=O)NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17F4N5O3/c1-11-16(12(2)28(27-11)15-6-4-14(21)5-7-15)10-19(30)26-25-17-8-3-13(20(22,23)24)9-18(17)29(31)32/h3-9,25H,10H2,1-2H3,(H,26,30) |
| InChIKey | SJXJRBJCONFBFG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|