C14H13F3N4O4 — CID 29409562
2-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]acetohydrazide (PubChem CID 29409562) has the molecular formula C14H13F3N4O4 and a molecular weight of 358.28 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]acetohydrazide.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]acetohydrazide |
|---|---|
| PubChem CID | 29409562 |
| Molecular Formula | C14H13F3N4O4 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]acetohydrazide |
| SMILES | Cc1noc(C)c1CC(=O)NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13F3N4O4/c1-7-10(8(2)25-20-7)6-13(22)19-18-11-4-3-9(14(15,16)17)5-12(11)21(23)24/h3-5,18H,6H2,1-2H3,(H,19,22) |
| InChIKey | NCCMJKUWUZTNCT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|