C18H18F3N3O5 — CID 29408778
3-(3,4-dimethoxyphenyl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]propanehydrazide (PubChem CID 29408778) has the molecular formula C18H18F3N3O5 and a molecular weight of 413.35 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]propanehydrazide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]propanehydrazide |
|---|---|
| PubChem CID | 29408778 |
| Molecular Formula | C18H18F3N3O5 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]propanehydrazide |
| SMILES | COc1ccc(CCC(=O)NNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H18F3N3O5/c1-28-15-7-3-11(9-16(15)29-2)4-8-17(25)23-22-13-6-5-12(18(19,20)21)10-14(13)24(26)27/h3,5-7,9-10,22H,4,8H2,1-2H3,(H,23,25) |
| InChIKey | ZFIMYNSFDDHMQU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|