C17H15F3N4O4 — CID 29409622
N-[4-[2-[2-[2-nitro-4-(trifluoromethyl)phenyl]hydrazinyl]-2-oxoethyl]phenyl]acetamide (PubChem CID 29409622) has the molecular formula C17H15F3N4O4 and a molecular weight of 396.33 g/mol. Its IUPAC name is N-[4-[2-[2-[2-nitro-4-(trifluoromethyl)phenyl]hydrazinyl]-2-oxoethyl]phenyl]acetamide.
| Compound Name | N-[4-[2-[2-[2-nitro-4-(trifluoromethyl)phenyl]hydrazinyl]-2-oxoethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 29409622 |
| Molecular Formula | C17H15F3N4O4 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-[4-[2-[2-[2-nitro-4-(trifluoromethyl)phenyl]hydrazinyl]-2-oxoethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CC(=O)NNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15F3N4O4/c1-10(25)21-13-5-2-11(3-6-13)8-16(26)23-22-14-7-4-12(17(18,19)20)9-15(14)24(27)28/h2-7,9,22H,8H2,1H3,(H,21,25)(H,23,26) |
| InChIKey | BVFGLTNEAAFFLK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|