C14H13F3N4O4S — CID 29409962
3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]propanehydrazide (PubChem CID 29409962) has the molecular formula C14H13F3N4O4S and a molecular weight of 390.34 g/mol. Its IUPAC name is 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]propanehydrazide.
| Compound Name | 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]propanehydrazide |
|---|---|
| PubChem CID | 29409962 |
| Molecular Formula | C14H13F3N4O4S |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]propanehydrazide |
| SMILES | Cc1csc(=O)n1CCC(=O)NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13F3N4O4S/c1-8-7-26-13(23)20(8)5-4-12(22)19-18-10-3-2-9(14(15,16)17)6-11(10)21(24)25/h2-3,6-7,18H,4-5H2,1H3,(H,19,22) |
| InChIKey | SNSVBVBMYZDGFZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 106.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|